CAS 135980-66-4 appears in our catalog under these names: 4-Methylsulfonyl-N-N-butyl-1,8-naphthalimide, MSBN/ 98.57% (existing batch purity), MSBN, MSBN, 98.51%. Offered by: Biosynth, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 50mg, 25mg, 100mg, 2mg, 5mg, 10mg, 200mg, 1mg.
2-butyl-6-methylsulfonylbenzo[de]isoquinoline-1,3-dione (CAS 135980-66-4) is a chemical compound with the molecular formula C17H17NO4S and a molecular weight of 331.4 g/mol. IUPAC name: 2-butyl-6-methylsulfonylbenzo[de]isoquinoline-1,3-dione. InChIKey: XJWPRGLACNOMLF-UHFFFAOYSA-N.
| Molecular formula | C17H17NO4S |
|---|---|
| Molecular weight | 331.4 g/mol |
| IUPAC name | 2-butyl-6-methylsulfonylbenzo[de]isoquinoline-1,3-dione |
| InChIKey | XJWPRGLACNOMLF-UHFFFAOYSA-N |
| SMILES | CCCCN1C(=O)C2=C3C(=C(C=C2)S(=O)(=O)C)C=CC=C3C1=O |
Computed by PubChem (NCBI)