Products 70991-61-6
CAS 70991-61-6 appears in our catalog under these names: MTPPA/ 99.26% (existing batch purity), MTPPA (M 5011), MTPPA. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 1 mg.
2-[4-(3-methylthiophen-2-yl)phenyl]propanoic acid (CAS 70991-61-6) is a chemical compound with the molecular formula C14H14O2S and a molecular weight of 246.33 g/mol. IUPAC name: 2-[4-(3-methylthiophen-2-yl)phenyl]propanoic acid. InChIKey: DTOPKPBTCXKNFF-UHFFFAOYSA-N.
| Molecular formula | C14H14O2S |
|---|---|
| Molecular weight | 246.33 g/mol |
| IUPAC name | 2-[4-(3-methylthiophen-2-yl)phenyl]propanoic acid |
| InChIKey | DTOPKPBTCXKNFF-UHFFFAOYSA-N |
| SMILES | CC1=C(SC=C1)C2=CC=C(C=C2)C(C)C(=O)O |
Computed by PubChem (NCBI)