Products 1185303-43-8
CAS 1185303-43-8 is the registry number for 2-(4-Chlorophenyl)-2-(pyrrolidin-1-yl)ethan-1-amine oxalate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(4-chlorophenyl)-2-pyrrolidin-1-ylethanamine;oxalic acid (CAS 1185303-43-8) is a chemical compound with the molecular formula C14H19ClN2O4 and a molecular weight of 314.76 g/mol. IUPAC name: 2-(4-chlorophenyl)-2-pyrrolidin-1-ylethanamine;oxalic acid. InChIKey: WOWFWJZCMDEOEX-UHFFFAOYSA-N.
| Molecular formula | C14H19ClN2O4 |
|---|---|
| Molecular weight | 314.76 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-2-pyrrolidin-1-ylethanamine;oxalic acid |
| InChIKey | WOWFWJZCMDEOEX-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)C(CN)C2=CC=C(C=C2)Cl.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)