CAS 855294-38-1 appears in our catalog under these names: 2-(Piperidin-2-yl)ethyl 3-nitrobenzoate hydrochloride, 95%, 2-(Piperidin-2-yl)ethyl 3-nitrobenzoate hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
2-piperidin-2-ylethyl 3-nitrobenzoate;hydrochloride (CAS 855294-38-1) is a chemical compound with the molecular formula C14H19ClN2O4 and a molecular weight of 314.76 g/mol. IUPAC name: 2-piperidin-2-ylethyl 3-nitrobenzoate;hydrochloride. InChIKey: NCKLUKVRJPUQAK-UHFFFAOYSA-N.
| Molecular formula | C14H19ClN2O4 |
|---|---|
| Molecular weight | 314.76 g/mol |
| IUPAC name | 2-piperidin-2-ylethyl 3-nitrobenzoate;hydrochloride |
| InChIKey | NCKLUKVRJPUQAK-UHFFFAOYSA-N |
| SMILES | C1CCNC(C1)CCOC(=O)C2=CC(=CC=C2)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)