Methyl 1H-indazole-5-carboxylate, 98%
cas: 473416-12-5 — see every product listed under this CAS number, including other names
Methyl 1H-indazole-5-carboxylate, 98% (CAS 473416-12-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g, 250g. Offered by: Chemat, BLDpharm, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch11456P-250mg |
| cas | 473416-12-5 |
| size | 250mg |
| availability | 1154.8g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 93.20 Pln | |
| Chemat | 10g | 122.00 Pln | |
| Chemat | 25g | 198.80 Pln | |
| Chemat | 50g | 323.60 Pln | |
| Chemat | 100g | 558.80 Pln | |
| Chemat | 250g | 1235.60 Pln | |
| Chemat | 500g | 2404.80 Pln | |
| Chemat | 1kg | 4317.20 Pln | |
| BLDpharm | 1g | 125.54 Pln | |
| BLDpharm | 5g | 203.29 Pln | |
| BLDpharm | 10g | 225.50 Pln | |
| BLDpharm | 25g | 353.23 Pln | |
| BLDpharm | 100g | 858.61 Pln | |
| BLDpharm | 500g | 4001.95 Pln | |
| BLDpharm | 1kg | 6362.23 Pln | |
| Fluorochem | 1g | 102.06 Pln | |
| Fluorochem | 5g | 133.30 Pln | |
| Fluorochem | 25g | 331.15 Pln | |
| Fluorochem | 100g | 820.56 Pln | |
| Fluorochem | 500g | 3798.68 Pln | |
| Fluorochem | 1kg | 6042.68 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Methyl 1H-indazole-5-carboxylate (CAS 473416-12-5) is a chemical compound with the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. IUPAC name: methyl 1H-indazole-5-carboxylate. InChIKey: LPLOEZPPYOSNEW-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O2 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | methyl 1H-indazole-5-carboxylate |
| InChIKey | LPLOEZPPYOSNEW-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=C1)NN=C2 |
Computed by PubChem (NCBI)
Synonyms:
Methyl 1H-Indazole-5-carboxylate, Methyl indazole-5-carboxylate, 1H-Indazole-5-carboxylic acid methyl ester, 5-(1H)Indazole carboxylic acid methyl ester, 5-(Methoxycarbonyl)-1H-indazole, 1H-Indazole-5-carboxylicacid, methyl ester, Methyl 5-1H-indazolecarboxylate, 1H-Indazole-5-carboxylic acid, methyl ester, 2H-Indazole-5-carboxylic acid methyl ester, Methyl 1H-5-Indazolecarboxylate