cas: 170487-40-8 — see every product listed under this CAS number, including other names
Methyl 1H-indazole-6-carboxylate, 98% (CAS 170487-40-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F788356-5G |
| cas | 170487-40-8 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 128.10 Pln | |
| Fluorochem | 10g | 169.75 Pln | |
| Fluorochem | 25g | 258.26 Pln | |
| Fluorochem | 100g | 841.39 Pln | |
| Fluorochem | 500g | 3975.70 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
Methyl 1H-indazole-6-carboxylate (CAS 170487-40-8) is a chemical compound with the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. IUPAC name: methyl 1H-indazole-6-carboxylate. InChIKey: TUSICEWIXLMXEY-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O2 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | methyl 1H-indazole-6-carboxylate |
| InChIKey | TUSICEWIXLMXEY-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=C1)C=NN2 |
Computed by PubChem (NCBI)