cas: 170487-40-8 — see every product listed under this CAS number, including other names
Methyl indazole-6-carboxylate (CAS 170487-40-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F077813-1G |
| cas | 170487-40-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 91.65 Pln | |
| Fluorochem | 5g | 102.07 Pln |
| delivery time | 2-3 weeks |
|---|
Methyl 1H-indazole-6-carboxylate (CAS 170487-40-8) is a chemical compound with the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. IUPAC name: methyl 1H-indazole-6-carboxylate. InChIKey: TUSICEWIXLMXEY-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O2 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | methyl 1H-indazole-6-carboxylate |
| InChIKey | TUSICEWIXLMXEY-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=C1)C=NN2 |
Computed by PubChem (NCBI)