cas: 603124-78-3 — see every product listed under this CAS number, including other names
Methyl 2,3-dichloroisonicotinate, 98%, 98% (CAS 603124-78-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EE8P-100mg |
| cas | 603124-78-3 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 136.40 Pln | |
| Chemat | 1g | 347.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Methyl 2,3-dichloropyridine-4-carboxylate (CAS 603124-78-3) is a chemical compound with the molecular formula C7H5Cl2NO2 and a molecular weight of 206.02 g/mol. IUPAC name: methyl 2,3-dichloropyridine-4-carboxylate. InChIKey: PFAVUXBECIRJIY-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2NO2 |
|---|---|
| Molecular weight | 206.02 g/mol |
| IUPAC name | methyl 2,3-dichloropyridine-4-carboxylate |
| InChIKey | PFAVUXBECIRJIY-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=NC=C1)Cl)Cl |
Computed by PubChem (NCBI)