CAS 603124-78-3 appears in our catalog under these names: Methyl 2,3-dichloroisonicotinate, 95%, Methyl 2，3–dichloroisonicotinate, Methyl 2,3-dichloroisonicotinate 95%, Methyl 2,3-dichloroisonicotinate, 98%, 98%, Methyl 2,3-dichloroisonicotinate, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 100mg, 10g.
Methyl 2,3-dichloropyridine-4-carboxylate (CAS 603124-78-3) is a chemical compound with the molecular formula C7H5Cl2NO2 and a molecular weight of 206.02 g/mol. IUPAC name: methyl 2,3-dichloropyridine-4-carboxylate. InChIKey: PFAVUXBECIRJIY-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2NO2 |
|---|---|
| Molecular weight | 206.02 g/mol |
| IUPAC name | methyl 2,3-dichloropyridine-4-carboxylate |
| InChIKey | PFAVUXBECIRJIY-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=NC=C1)Cl)Cl |
Computed by PubChem (NCBI)