Methyl 2,3-difluoro-4-hydroxybenzoate, 98%, 98%
cas: 219685-84-4 — see every product listed under this CAS number, including other names
Methyl 2,3-difluoro-4-hydroxybenzoate, 98%, 98% (CAS 219685-84-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I50R-100mg |
| cas | 219685-84-4 |
| size | 100mg |
| availability | 100g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 174.80 Pln | |
| Chemat | 250mg | 261.20 Pln | |
| Chemat | 1g | 544.40 Pln | |
| Chemat | 5g | 890.00 Pln | |
| Chemat | 10g | 1614.80 Pln | |
| Chemat | 25g | 3165.20 Pln | |
| Chemat | 50g | 4485.20 Pln | |
| Chemat | 100g | 7437.20 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Methyl 2,3-difluoro-4-hydroxybenzoate (CAS 219685-84-4) is a chemical compound with the molecular formula C8H6F2O3 and a molecular weight of 188.13 g/mol. IUPAC name: methyl 2,3-difluoro-4-hydroxybenzoate. InChIKey: ZHLFIRVEFRQYRB-UHFFFAOYSA-N.
| Molecular formula | C8H6F2O3 |
|---|---|
| Molecular weight | 188.13 g/mol |
| IUPAC name | methyl 2,3-difluoro-4-hydroxybenzoate |
| InChIKey | ZHLFIRVEFRQYRB-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=C(C=C1)O)F)F |
Computed by PubChem (NCBI)
Synonyms:
methyl 2,3-difluoro-4-hydroxybenzoate, Benzoic acid, 2,3-difluoro-4-hydroxy-, methyl ester, ZHLFIRVEFRQYRB-UHFFFAOYSA-N, methyl2,3-difluoro-4-hydroxybenzoate, methyl 2,3-difluoro-4-hydroxy-benzoate, 2,3-Difluoro-4-hydroxybenzoicacid methyl ester, 2,3-difluoro-4-hydroxy-benzoic acid methyl ester, 4-hydroxy-2,3-difluoro-benzoic acid methyl ester