cas: 219685-84-4 — see every product listed under this CAS number, including other names
Methyl 2,3-difluoro-4-hydroxybenzoate, 98% (CAS 219685-84-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F621304-100MG |
| cas | 219685-84-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 268.67 Pln | |
| Fluorochem | 250mg | 404.04 Pln | |
| Fluorochem | 1g | 888.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 2,3-difluoro-4-hydroxybenzoate (CAS 219685-84-4) is a chemical compound with the molecular formula C8H6F2O3 and a molecular weight of 188.13 g/mol. IUPAC name: methyl 2,3-difluoro-4-hydroxybenzoate. InChIKey: ZHLFIRVEFRQYRB-UHFFFAOYSA-N.
| Molecular formula | C8H6F2O3 |
|---|---|
| Molecular weight | 188.13 g/mol |
| IUPAC name | methyl 2,3-difluoro-4-hydroxybenzoate |
| InChIKey | ZHLFIRVEFRQYRB-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=C(C=C1)O)F)F |
Computed by PubChem (NCBI)