CAS 153072-43-6 appears in our catalog under these names: Methyl 4-isatincarboxylate, 96%, Methyl 2,3–dioxoindoline–4–carboxylate, Methyl 2,3-dioxoindoline-4-carboxylate, 95%, 95%, Methyl 2,3-dioxoindoline-4-carboxylate, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 100mg, 5g, 10g.
Methyl 2,3-dioxo-1H-indole-4-carboxylate (CAS 153072-43-6) is a chemical compound with the molecular formula C10H7NO4 and a molecular weight of 205.17 g/mol. IUPAC name: methyl 2,3-dioxo-1H-indole-4-carboxylate. InChIKey: DKKOUROAVJVZRT-UHFFFAOYSA-N.
| Molecular formula | C10H7NO4 |
|---|---|
| Molecular weight | 205.17 g/mol |
| IUPAC name | methyl 2,3-dioxo-1H-indole-4-carboxylate |
| InChIKey | DKKOUROAVJVZRT-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C2C(=CC=C1)NC(=O)C2=O |
Computed by PubChem (NCBI)