cas: 70920-59-1 — see every product listed under this CAS number, including other names
Methyl 2,4,6-trimethylbenzenesulfonate 97% (CAS 70920-59-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A193131-250mg |
| cas | 70920-59-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 248.00 Pln | |
| Ambeed | 1g | 331.44 Pln | |
| Ambeed | 5g | 854.31 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A193131 |
Methyl 2,4,6-trimethylbenzenesulfonate (CAS 70920-59-1) is a chemical compound with the molecular formula C10H14O3S and a molecular weight of 214.28 g/mol. IUPAC name: methyl 2,4,6-trimethylbenzenesulfonate. InChIKey: VCXKHPUXNZJDDG-UHFFFAOYSA-N.
| Molecular formula | C10H14O3S |
|---|---|
| Molecular weight | 214.28 g/mol |
| IUPAC name | methyl 2,4,6-trimethylbenzenesulfonate |
| InChIKey | VCXKHPUXNZJDDG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)S(=O)(=O)OC)C |
Computed by PubChem (NCBI)