cas: 129788-30-3 — see every product listed under this CAS number, including other names
Methyl 2,4-dichloro-3-hydroxybenzoate (CAS 129788-30-3) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F630786-1G |
| cas | 129788-30-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 5876.07 Pln |
| delivery time | 3-4 weeks |
|---|
Methyl 2,4-dichloro-3-hydroxybenzoate (CAS 129788-30-3) is a chemical compound with the molecular formula C8H6Cl2O3 and a molecular weight of 221.03 g/mol. IUPAC name: methyl 2,4-dichloro-3-hydroxybenzoate. InChIKey: VYNDIGYHEFCBEG-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2O3 |
|---|---|
| Molecular weight | 221.03 g/mol |
| IUPAC name | methyl 2,4-dichloro-3-hydroxybenzoate |
| InChIKey | VYNDIGYHEFCBEG-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=C(C=C1)Cl)O)Cl |
Computed by PubChem (NCBI)