cas: 1214332-41-8 — see every product listed under this CAS number, including other names
Methyl 2,6-difluoro-3-hydroxybenzoate 98% (CAS 1214332-41-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A608254-100mg |
| cas | 1214332-41-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 531.69 Pln | |
| Ambeed | 250mg | 837.62 Pln | |
| Ambeed | 1g | 1766.56 Pln | |
| Ambeed | 5g | 5154.12 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A608254 |
Methyl 2,6-difluoro-3-hydroxybenzoate (CAS 1214332-41-8) is a chemical compound with the molecular formula C8H6F2O3 and a molecular weight of 188.13 g/mol. IUPAC name: methyl 2,6-difluoro-3-hydroxybenzoate. InChIKey: IJXKUYJHKDPVBN-UHFFFAOYSA-N.
| Molecular formula | C8H6F2O3 |
|---|---|
| Molecular weight | 188.13 g/mol |
| IUPAC name | methyl 2,6-difluoro-3-hydroxybenzoate |
| InChIKey | IJXKUYJHKDPVBN-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1F)O)F |
Computed by PubChem (NCBI)