cas: 108258-54-4 — see every product listed under this CAS number, including other names
Methyl 2,3-dichloroquinoxaline-6-carboxylate, 98%, 98% (CAS 108258-54-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11051F-250mg |
| cas | 108258-54-4 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 146.00 Pln | |
| Chemat | 1g | 400.40 Pln | |
| Chemat | 5g | 1533.20 Pln | |
| Chemat | 100mg | 122.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Methyl 2,3-dichloroquinoxaline-6-carboxylate (CAS 108258-54-4) is a chemical compound with the molecular formula C10H6Cl2N2O2 and a molecular weight of 257.07 g/mol. IUPAC name: methyl 2,3-dichloroquinoxaline-6-carboxylate. InChIKey: ZLWYANCDEVPWLW-UHFFFAOYSA-N.
| Molecular formula | C10H6Cl2N2O2 |
|---|---|
| Molecular weight | 257.07 g/mol |
| IUPAC name | methyl 2,3-dichloroquinoxaline-6-carboxylate |
| InChIKey | ZLWYANCDEVPWLW-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=C1)N=C(C(=N2)Cl)Cl |
Computed by PubChem (NCBI)