CAS 1805594-04-0 appears in our catalog under these names: Methyl 2-(2-bromo-3,6-difluorophenyl)acetate, 98%, Methyl 2-(2-bromo-3,6-difluorophenyl)acetate, 95%, 95%, Methyl 2-(2-bromo-3,6-difluorophenyl)acetate, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g.
Methyl 2-(2-bromo-3,6-difluorophenyl)acetate (CAS 1805594-04-0) is a chemical compound with the molecular formula C9H7BrF2O2 and a molecular weight of 265.05 g/mol. IUPAC name: methyl 2-(2-bromo-3,6-difluorophenyl)acetate. InChIKey: YVPWMSMBKNMETG-UHFFFAOYSA-N.
| Molecular formula | C9H7BrF2O2 |
|---|---|
| Molecular weight | 265.05 g/mol |
| IUPAC name | methyl 2-(2-bromo-3,6-difluorophenyl)acetate |
| InChIKey | YVPWMSMBKNMETG-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1=C(C=CC(=C1Br)F)F |
Computed by PubChem (NCBI)