cas: 99075-25-9 — see every product listed under this CAS number, including other names
Methyl 2-(4-(aminomethyl)phenyl)acetate hydrochloride, 96% (CAS 99075-25-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 2g, 2.5g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F231420-100MG |
| cas | 99075-25-9 |
| size | 100mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 133.30 Pln | |
| Fluorochem | 250mg | 180.16 Pln | |
| Fluorochem | 1g | 513.38 Pln | |
| Fluorochem | 2g | 799.74 Pln | |
| Fluorochem | 2.5g | 919.49 Pln | |
| Fluorochem | 5g | 1523.44 Pln | |
| Fluorochem | 10g | 2382.51 Pln | |
| Fluorochem | 25g | 5089.89 Pln |
| purity | 96% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
Methyl 2-[4-(aminomethyl)phenyl]acetate;hydrochloride (CAS 99075-25-9) is a chemical compound with the molecular formula C10H14ClNO2 and a molecular weight of 215.67 g/mol. IUPAC name: methyl 2-[4-(aminomethyl)phenyl]acetate;hydrochloride. InChIKey: XRUYKKFDXVIMPE-UHFFFAOYSA-N.
| Molecular formula | C10H14ClNO2 |
|---|---|
| Molecular weight | 215.67 g/mol |
| IUPAC name | methyl 2-[4-(aminomethyl)phenyl]acetate;hydrochloride |
| InChIKey | XRUYKKFDXVIMPE-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1=CC=C(C=C1)CN.Cl |
Computed by PubChem (NCBI)