Products 99075-25-9
CAS 99075-25-9 appears in our catalog under these names: Methyl 2-(4-(aminomethyl)phenyl)acetate hydrochloride, 95%, Methyl 2–(4–(aminomethyl)phenyl)acetate hydrochloride, Methyl 2-(4-(aminomethyl)phenyl)acetate hydrochloride, Methyl 2-(4-(aminomethyl)phenyl)acetate (hydrochloride), 97.0%, Methyl 2-(4-(aminomethyl)phenyl)acetate HCl, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, MedChemExpress, Ambeed. Available pack sizes: 250mg, 1g, 5g, 100mg, 2,5g, 1 g, 100 mg, 500 mg.
Methyl 2-[4-(aminomethyl)phenyl]acetate;hydrochloride (CAS 99075-25-9) is a chemical compound with the molecular formula C10H14ClNO2 and a molecular weight of 215.67 g/mol. IUPAC name: methyl 2-[4-(aminomethyl)phenyl]acetate;hydrochloride. InChIKey: XRUYKKFDXVIMPE-UHFFFAOYSA-N.
| Molecular formula | C10H14ClNO2 |
|---|---|
| Molecular weight | 215.67 g/mol |
| IUPAC name | methyl 2-[4-(aminomethyl)phenyl]acetate;hydrochloride |
| InChIKey | XRUYKKFDXVIMPE-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1=CC=C(C=C1)CN.Cl |
Computed by PubChem (NCBI)
Synonyms:
Methyl [4-(aminomethyl)phenyl]acetate HCl, methyl 2-[4-(aminomethyl)phenyl]acetate;hydrochloride, methyl 4-Aminomethylphenylacetate hydrochloride, Methyl 2-(4-(aminomethyl)phenyl)acetate HCl, Methyl 2-(4-(aminomethyl);phenyl);acetate hydrochloride, methyl 4-(aminomethyl)phenylacetate hydrochloride, Methyl 2-(4-(aminomethyl)phenyl)-acetate hydrochloride, 4-(Aminomethyl)benzeneacetic acid methyl ester hydrochloride, Benzeneacetic acid, 4-(aminomethyl)-, methyl ester, hydrochloride, methyl 4-Aminomet