Methyl 2-(4-acetyl-2-fluorophenyl)acetate, 97%
cas: 2089292-03-3 — see every product listed under this CAS number, including other names
Methyl 2-(4-acetyl-2-fluorophenyl)acetate, 97% (CAS 2089292-03-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F865325-100MG |
| cas | 2089292-03-3 |
| size | 100mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 357.18 Pln | |
| Fluorochem | 250mg | 549.82 Pln | |
| Fluorochem | 1g | 1336.01 Pln | |
| Ambeed | 100mg | 248.00 Pln | |
| Ambeed | 250mg | 337.00 Pln | |
| Ambeed | 1g | 793.12 Pln | |
| Ambeed | 5g | 2968.06 Pln | |
| Chemat | 100mg | 251.60 Pln | |
| Chemat | 250mg | 381.20 Pln | |
| Chemat | 1g | 923.60 Pln | |
| Chemat | 5g | 3506.00 Pln | |
| BLDpharm | 100mg | 264.38 Pln | |
| BLDpharm | 250mg | 353.23 Pln | |
| BLDpharm | 1g | 853.06 Pln | |
| BLDpharm | 5g | 3196.68 Pln |
properties
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
Methyl 2-(4-acetyl-2-fluorophenyl)acetate (CAS 2089292-03-3) is a chemical compound with the molecular formula C11H11FO3 and a molecular weight of 210.20 g/mol. IUPAC name: methyl 2-(4-acetyl-2-fluorophenyl)acetate. InChIKey: DXPPXAOJPFQWEW-UHFFFAOYSA-N.
| Molecular formula | C11H11FO3 |
|---|---|
| Molecular weight | 210.20 g/mol |
| IUPAC name | methyl 2-(4-acetyl-2-fluorophenyl)acetate |
| InChIKey | DXPPXAOJPFQWEW-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C=C1)CC(=O)OC)F |
Computed by PubChem (NCBI)