Products 2089292-03-3
CAS 2089292-03-3 is the registry number for Methyl 2-(4-acetyl-2-fluorophenyl)acetate, 97%. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm. Available pack sizes: 100mg, 250mg, 1g, 5g.
Methyl 2-(4-acetyl-2-fluorophenyl)acetate (CAS 2089292-03-3) is a chemical compound with the molecular formula C11H11FO3 and a molecular weight of 210.20 g/mol. IUPAC name: methyl 2-(4-acetyl-2-fluorophenyl)acetate. InChIKey: DXPPXAOJPFQWEW-UHFFFAOYSA-N.
| Molecular formula | C11H11FO3 |
|---|---|
| Molecular weight | 210.20 g/mol |
| IUPAC name | methyl 2-(4-acetyl-2-fluorophenyl)acetate |
| InChIKey | DXPPXAOJPFQWEW-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C=C1)CC(=O)OC)F |
Computed by PubChem (NCBI)