cas: 90484-52-9 — see every product listed under this CAS number, including other names
Methyl 2-bromo-4-formylbenzoate, 95%, 95% (CAS 90484-52-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12BS2W-100mg |
| cas | 90484-52-9 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 424.40 Pln | |
| Chemat | 250mg | 640.40 Pln | |
| Chemat | 1g | 1562.00 Pln | |
| Chemat | 5g | 5315.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Methyl 2-bromo-4-formylbenzoate (CAS 90484-52-9) is a chemical compound with the molecular formula C9H7BrO3 and a molecular weight of 243.05 g/mol. IUPAC name: methyl 2-bromo-4-formylbenzoate. InChIKey: HVGRXTUWUNHKJB-UHFFFAOYSA-N.
| Molecular formula | C9H7BrO3 |
|---|---|
| Molecular weight | 243.05 g/mol |
| IUPAC name | methyl 2-bromo-4-formylbenzoate |
| InChIKey | HVGRXTUWUNHKJB-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)C=O)Br |
Computed by PubChem (NCBI)