Methyl 2-hydroxy-1-naphthoate 95%
cas: 947-65-9 — see every product listed under this CAS number, including other names
Methyl 2-hydroxy-1-naphthoate 95% (CAS 947-65-9) is a chemical reagent available from Chemat. Available pack sizes: 100g, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A223222-100g |
| cas | 947-65-9 |
| size | 100g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100g | 3524.31 Pln | |
| Ambeed | 1g | 203.50 Pln | |
| Ambeed | 5g | 426.00 Pln | |
| Ambeed | 10g | 676.31 Pln | |
| Ambeed | 25g | 1149.12 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A223222 |
Methyl 2-hydroxynaphthalene-1-carboxylate (CAS 947-65-9) is a chemical compound with the molecular formula C12H10O3 and a molecular weight of 202.21 g/mol. IUPAC name: methyl 2-hydroxynaphthalene-1-carboxylate. InChIKey: LEENMPKUUNPLHM-UHFFFAOYSA-N.
| Molecular formula | C12H10O3 |
|---|---|
| Molecular weight | 202.21 g/mol |
| IUPAC name | methyl 2-hydroxynaphthalene-1-carboxylate |
| InChIKey | LEENMPKUUNPLHM-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC2=CC=CC=C21)O |
Computed by PubChem (NCBI)
Synonyms:
Methyl 2-hydroxy-1-naphthoate, methyl 2-hydroxynaphthalene-1-carboxylate, Methyl-2-hydroxy-1-naphthalene carboxylate, 2-Hydroxy-1-naphthoic acid methyl ester, 2-Hydroxynaphthalene-1-carboxylic acid methyl ester, 1-Naphthalenecarboxylic acid, 2-hydroxy-, methyl ester, Oprea1_467520, 2-hydroxy-1-naphthalenecarboxylic acid methyl ester, Methyl 2-hydroxy-1-naphthoate #, 2-Hydroxy-1-naphthoate methyl ester