cas: 1031967-52-8 — see every product listed under this CAS number, including other names
Methyl 2H-benzo[e][1,2,4]thiadiazine-3-carboxylate 1,1-dioxide, 98% (CAS 1031967-52-8) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g, 2.5g, 5g. Offered by: Fluorochem, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F611290-50MG |
| cas | 1031967-52-8 |
| size | 50mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 1205.84 Pln | |
| Fluorochem | 100mg | 1700.46 Pln | |
| Fluorochem | 250mg | 2799.03 Pln | |
| Fluorochem | 500mg | 3965.29 Pln | |
| Fluorochem | 1g | 5485.59 Pln | |
| Fluorochem | 2.5g | 10431.76 Pln | |
| Fluorochem | 5g | 14695.88 Pln | |
| Chemat | 50mg | 827.60 Pln | |
| Chemat | 100mg | 1250.00 Pln | |
| Chemat | 250mg | 2042.00 Pln | |
| Chemat | 500mg | 3016.40 Pln | |
| Chemat | 1g | 4019.60 Pln |
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
Methyl 1,1-dioxo-4H-1lambda6,2,4-benzothiadiazine-3-carboxylate (CAS 1031967-52-8) is a chemical compound with the molecular formula C9H8N2O4S and a molecular weight of 240.24 g/mol. IUPAC name: methyl 1,1-dioxo-4H-1lambda6,2,4-benzothiadiazine-3-carboxylate. InChIKey: RBUIIACICBXIQB-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O4S |
|---|---|
| Molecular weight | 240.24 g/mol |
| IUPAC name | methyl 1,1-dioxo-4H-1lambda6,2,4-benzothiadiazine-3-carboxylate |
| InChIKey | RBUIIACICBXIQB-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NS(=O)(=O)C2=CC=CC=C2N1 |
Computed by PubChem (NCBI)