CAS 881474-11-9 appears in our catalog under these names: 2-Methyl-1,3-dioxo-2,3-dihydro-1H-isoindole-5-sulfonamide, 95%, 2-Methyl-1,3-dioxo-2,3-dihydro-1H-isoindole-5-sulfonamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
2-methyl-1,3-dioxoisoindole-5-sulfonamide (CAS 881474-11-9) is a chemical compound with the molecular formula C9H8N2O4S and a molecular weight of 240.24 g/mol. IUPAC name: 2-methyl-1,3-dioxoisoindole-5-sulfonamide. InChIKey: DTORYAQGVDUHIX-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O4S |
|---|---|
| Molecular weight | 240.24 g/mol |
| IUPAC name | 2-methyl-1,3-dioxoisoindole-5-sulfonamide |
| InChIKey | DTORYAQGVDUHIX-UHFFFAOYSA-N |
| SMILES | CN1C(=O)C2=C(C1=O)C=C(C=C2)S(=O)(=O)N |
Computed by PubChem (NCBI)