CAS 929972-24-7 appears in our catalog under these names: Cyanomethyl 4-(aminosulfonyl)benzoate, 95%, Cyanomethyl 4-(aminosulfonyl)benzoate. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g.
Cyanomethyl 4-sulfamoylbenzoate (CAS 929972-24-7) is a chemical compound with the molecular formula C9H8N2O4S and a molecular weight of 240.24 g/mol. IUPAC name: cyanomethyl 4-sulfamoylbenzoate. InChIKey: FKRUTRMQCRUPCC-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O4S |
|---|---|
| Molecular weight | 240.24 g/mol |
| IUPAC name | cyanomethyl 4-sulfamoylbenzoate |
| InChIKey | FKRUTRMQCRUPCC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)OCC#N)S(=O)(=O)N |
Computed by PubChem (NCBI)