CAS 214841-99-3 appears in our catalog under these names: ([(4-Cyanophenyl)sulfonyl]amino)acetic acid, 95%, 2-(4-Cyanobenzenesulfonamido)acetic acid, 95%, 2-(4-Cyanobenzenesulfonamido)acetic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g, 0,5g.
2-[(4-cyanophenyl)sulfonylamino]acetic acid (CAS 214841-99-3) is a chemical compound with the molecular formula C9H8N2O4S and a molecular weight of 240.24 g/mol. IUPAC name: 2-[(4-cyanophenyl)sulfonylamino]acetic acid. InChIKey: FDHUUEBQWGBPMV-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O4S |
|---|---|
| Molecular weight | 240.24 g/mol |
| IUPAC name | 2-[(4-cyanophenyl)sulfonylamino]acetic acid |
| InChIKey | FDHUUEBQWGBPMV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C#N)S(=O)(=O)NCC(=O)O |
Computed by PubChem (NCBI)