CAS 2383491-72-1 is the registry number for 6-(Ethoxycarbonyl)imidazo[2,1-b]thiazole-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-ethoxycarbonylimidazo[2,1-b][1,3]thiazole-2-carboxylic acid (CAS 2383491-72-1) is a chemical compound with the molecular formula C9H8N2O4S and a molecular weight of 240.24 g/mol. IUPAC name: 6-ethoxycarbonylimidazo[2,1-b][1,3]thiazole-2-carboxylic acid. InChIKey: XUXDTZPPQYIQDX-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O4S |
|---|---|
| Molecular weight | 240.24 g/mol |
| IUPAC name | 6-ethoxycarbonylimidazo[2,1-b][1,3]thiazole-2-carboxylic acid |
| InChIKey | XUXDTZPPQYIQDX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN2C=C(SC2=N1)C(=O)O |
Computed by PubChem (NCBI)