CAS 872107-94-3 appears in our catalog under these names: 3-(2-Oxo-5-thien-2-yl-1,3,4-oxadiazol-3(2h)-yl)propanoic acid, 95%, 3-(2-Oxo-5-(thiophen-2-yl)-2,3-dihydro-1,3,4-oxadiazol-3-yl)propanoic acid, 3-(2-Oxo-5-(thiophen-2-yl)-2,3-dihydro-1,3,4-oxadiazol-3-yl)propanoic acid, 95%. Offered by: Combi-blocks, Biosynth, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
3-(2-oxo-5-thiophen-2-yl-1,3,4-oxadiazol-3-yl)propanoic acid (CAS 872107-94-3) is a chemical compound with the molecular formula C9H8N2O4S and a molecular weight of 240.24 g/mol. IUPAC name: 3-(2-oxo-5-thiophen-2-yl-1,3,4-oxadiazol-3-yl)propanoic acid. InChIKey: ZHQCFXRTKFZAJJ-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O4S |
|---|---|
| Molecular weight | 240.24 g/mol |
| IUPAC name | 3-(2-oxo-5-thiophen-2-yl-1,3,4-oxadiazol-3-yl)propanoic acid |
| InChIKey | ZHQCFXRTKFZAJJ-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C2=NN(C(=O)O2)CCC(=O)O |
Computed by PubChem (NCBI)