CAS 1031967-52-8 appears in our catalog under these names: Methyl 2H-benzo(e)(1,2,4)thiadiazine-3-carboxylate 1,1-dioxide, 98%, Methyl 2H-benzo[e][1,2,4]thiadiazine-3-carboxylate 1,1-dioxide, 98%, 98%, Methyl 2H-benzo[e][1,2,4]thiadiazine-3-carboxylate 1,1-dioxide, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 50mg, 100mg, 250mg, 1g, 500mg, 2.5g.
Methyl 1,1-dioxo-4H-1lambda6,2,4-benzothiadiazine-3-carboxylate (CAS 1031967-52-8) is a chemical compound with the molecular formula C9H8N2O4S and a molecular weight of 240.24 g/mol. IUPAC name: methyl 1,1-dioxo-4H-1lambda6,2,4-benzothiadiazine-3-carboxylate. InChIKey: RBUIIACICBXIQB-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O4S |
|---|---|
| Molecular weight | 240.24 g/mol |
| IUPAC name | methyl 1,1-dioxo-4H-1lambda6,2,4-benzothiadiazine-3-carboxylate |
| InChIKey | RBUIIACICBXIQB-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NS(=O)(=O)C2=CC=CC=C2N1 |
Computed by PubChem (NCBI)