CAS 24683-22-5 is the registry number for 4-Hydroxy-2H-1,2-benzothiazine-3-carboxamide 1,1-Dioxide. Offered by: Mikromol. Available pack sizes: 25mg.
4-hydroxy-1,1-dioxo-2H-1lambda6,2-benzothiazine-3-carboxamide (CAS 24683-22-5) is a chemical compound with the molecular formula C9H8N2O4S and a molecular weight of 240.24 g/mol. IUPAC name: 4-hydroxy-1,1-dioxo-2H-1lambda6,2-benzothiazine-3-carboxamide. InChIKey: KIRHSGGIMMTVPT-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O4S |
|---|---|
| Molecular weight | 240.24 g/mol |
| IUPAC name | 4-hydroxy-1,1-dioxo-2H-1lambda6,2-benzothiazine-3-carboxamide |
| InChIKey | KIRHSGGIMMTVPT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C(NS2(=O)=O)C(=O)N)O |
Computed by PubChem (NCBI)