cas: 212322-17-3 — see every product listed under this CAS number, including other names
Methyl 3-amino-4-formylbenzoate, 98% (CAS 212322-17-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 250mg, 1g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A1356934-5g |
| cas | 212322-17-3 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 10225.60 Pln | |
| Fluorochem | 250mg | 846.59 Pln | |
| Fluorochem | 1g | 1195.43 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
Methyl 3-amino-4-formylbenzoate (CAS 212322-17-3) is a chemical compound with the molecular formula C9H9NO3 and a molecular weight of 179.17 g/mol. IUPAC name: methyl 3-amino-4-formylbenzoate. InChIKey: XFULTVJWWNIPPO-UHFFFAOYSA-N.
| Molecular formula | C9H9NO3 |
|---|---|
| Molecular weight | 179.17 g/mol |
| IUPAC name | methyl 3-amino-4-formylbenzoate |
| InChIKey | XFULTVJWWNIPPO-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)C=O)N |
Computed by PubChem (NCBI)