cas: 212322-17-3 — see every product listed under this CAS number, including other names
Methyl-3-amino-4-formylbenzoate, 95%+, 95%+ (CAS 212322-17-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12JI9Y-100mg |
| cas | 212322-17-3 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 366.80 Pln | |
| Chemat | 250mg | 698.00 Pln | |
| Chemat | 1g | 1552.40 Pln | |
| Chemat | 5g | 5085.20 Pln |
| purity | 95%+ |
|---|---|
| delivery time | 3 weeks |
Methyl 3-amino-4-formylbenzoate (CAS 212322-17-3) is a chemical compound with the molecular formula C9H9NO3 and a molecular weight of 179.17 g/mol. IUPAC name: methyl 3-amino-4-formylbenzoate. InChIKey: XFULTVJWWNIPPO-UHFFFAOYSA-N.
| Molecular formula | C9H9NO3 |
|---|---|
| Molecular weight | 179.17 g/mol |
| IUPAC name | methyl 3-amino-4-formylbenzoate |
| InChIKey | XFULTVJWWNIPPO-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)C=O)N |
Computed by PubChem (NCBI)