cas: 706820-79-3 — see every product listed under this CAS number, including other names
Methyl 3-bromo-5-formyl-4-hydroxybenzoate, 95%, 95% (CAS 706820-79-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11FGP6-100mg |
| cas | 706820-79-3 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 261.20 Pln | |
| Chemat | 250mg | 400.40 Pln | |
| Chemat | 1g | 942.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Methyl 3-bromo-5-formyl-4-hydroxybenzoate (CAS 706820-79-3) is a chemical compound with the molecular formula C9H7BrO4 and a molecular weight of 259.05 g/mol. IUPAC name: methyl 3-bromo-5-formyl-4-hydroxybenzoate. InChIKey: XHKGRKFKESLQFV-UHFFFAOYSA-N.
| Molecular formula | C9H7BrO4 |
|---|---|
| Molecular weight | 259.05 g/mol |
| IUPAC name | methyl 3-bromo-5-formyl-4-hydroxybenzoate |
| InChIKey | XHKGRKFKESLQFV-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C(=C1)Br)O)C=O |
Computed by PubChem (NCBI)