cas: 198273-13-1 — see every product listed under this CAS number, including other names
Methyl 3-cyano-2,4-dichlorobenzoate (CAS 198273-13-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F631281-1G |
| cas | 198273-13-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 6266.56 Pln | |
| Fluorochem | 5g | 18652.82 Pln |
| delivery time | 3-4 weeks |
|---|
Methyl 2,4-dichloro-3-cyanobenzoate (CAS 198273-13-1) is a chemical compound with the molecular formula C9H5Cl2NO2 and a molecular weight of 230.04 g/mol. IUPAC name: methyl 2,4-dichloro-3-cyanobenzoate. InChIKey: JITBLAYTOQLGNF-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl2NO2 |
|---|---|
| Molecular weight | 230.04 g/mol |
| IUPAC name | methyl 2,4-dichloro-3-cyanobenzoate |
| InChIKey | JITBLAYTOQLGNF-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=C(C=C1)Cl)C#N)Cl |
Computed by PubChem (NCBI)