cas: 1805664-26-9 — see every product listed under this CAS number, including other names
Methyl 3-cyano-2,4-difluorobenzoate (CAS 1805664-26-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F630590-1G |
| cas | 1805664-26-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 7411.99 Pln | |
| Fluorochem | 5g | 22104.73 Pln |
| delivery time | 3-4 weeks |
|---|
Methyl 3-cyano-2,4-difluorobenzoate (CAS 1805664-26-9) is a chemical compound with the molecular formula C9H5F2NO2 and a molecular weight of 197.14 g/mol. IUPAC name: methyl 3-cyano-2,4-difluorobenzoate. InChIKey: JCEMJYDKHJMHQS-UHFFFAOYSA-N.
| Molecular formula | C9H5F2NO2 |
|---|---|
| Molecular weight | 197.14 g/mol |
| IUPAC name | methyl 3-cyano-2,4-difluorobenzoate |
| InChIKey | JCEMJYDKHJMHQS-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=C(C=C1)F)C#N)F |
Computed by PubChem (NCBI)