cas: 31827-04-0 — see every product listed under this CAS number, including other names
Methyl 3-hydroxy-1H-indole-2-carboxylate, 98% (CAS 31827-04-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F322010-100MG |
| cas | 31827-04-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 154.13 Pln | |
| Fluorochem | 250mg | 253.05 Pln | |
| Fluorochem | 1g | 409.25 Pln | |
| Fluorochem | 5g | 987.17 Pln | |
| Fluorochem | 25g | 3350.92 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 3-hydroxy-1H-indole-2-carboxylate (CAS 31827-04-0) is a chemical compound with the molecular formula C10H9NO3 and a molecular weight of 191.18 g/mol. IUPAC name: methyl 3-hydroxy-1H-indole-2-carboxylate. InChIKey: GHRXPKBLHFSXTB-UHFFFAOYSA-N.
| Molecular formula | C10H9NO3 |
|---|---|
| Molecular weight | 191.18 g/mol |
| IUPAC name | methyl 3-hydroxy-1H-indole-2-carboxylate |
| InChIKey | GHRXPKBLHFSXTB-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C2=CC=CC=C2N1)O |
Computed by PubChem (NCBI)