Products 31827-04-0
CAS 31827-04-0 appears in our catalog under these names: 3-Hydroxyindole-2-carboxylic acid methyl ester, 98%, 3-Hydroxyindole-2-carboxylic acid methyl ester, Methyl 3-hydroxy-1H-indole-2-carboxylate 98%, Methyl 3-hydroxy-1H-indole-2-carboxylate, 98%, 98%, 3-Hydroxyindole-2-carboxylic acid methyl, ester, 1 g. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Roth. Available pack sizes: 25g, 5g, 10g, 1g, 2g, 100mg, 250mg.
Methyl 3-hydroxy-1H-indole-2-carboxylate (CAS 31827-04-0) is a chemical compound with the molecular formula C10H9NO3 and a molecular weight of 191.18 g/mol. IUPAC name: methyl 3-hydroxy-1H-indole-2-carboxylate. InChIKey: GHRXPKBLHFSXTB-UHFFFAOYSA-N.
| Molecular formula | C10H9NO3 |
|---|---|
| Molecular weight | 191.18 g/mol |
| IUPAC name | methyl 3-hydroxy-1H-indole-2-carboxylate |
| InChIKey | GHRXPKBLHFSXTB-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C2=CC=CC=C2N1)O |
Computed by PubChem (NCBI)