cas: 90395-47-4 — see every product listed under this CAS number, including other names
Methyl 4-(3-pyridyl)benzoate, 95-<97% (CAS 90395-47-4) is a chemical reagent available from Chemat. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g. Offered by: Hoffman Fine Chemicals.
| brand | Hoffman Fine Chemicals |
|---|---|
| catalog number | HFC3332-95-97-2.5g |
| cas | 90395-47-4 |
| size | 2,5g |
| availability | 3-4 tygodnie|3-4 weeks |
| brand | size | price | |
|---|---|---|---|
| Hoffman Fine Chemicals | 2,5g | 3912.70 Pln | |
| Hoffman Fine Chemicals | 5g | 6075.52 Pln | |
| Hoffman Fine Chemicals | 10g | 9539.86 Pln | |
| Hoffman Fine Chemicals | 25g | 18771.72 Pln | |
| Hoffman Fine Chemicals | 50g | 31697.60 Pln |
| purity | 95-<97% |
|---|---|
| category | Chemicals |
| delivery time | 3-4 weeks |
Methyl 4-pyridin-3-ylbenzoate (CAS 90395-47-4) is a chemical compound with the molecular formula C13H11NO2 and a molecular weight of 213.23 g/mol. IUPAC name: methyl 4-pyridin-3-ylbenzoate. InChIKey: SMXKPSLCRALELV-UHFFFAOYSA-N.
| Molecular formula | C13H11NO2 |
|---|---|
| Molecular weight | 213.23 g/mol |
| IUPAC name | methyl 4-pyridin-3-ylbenzoate |
| InChIKey | SMXKPSLCRALELV-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)C2=CN=CC=C2 |
Computed by PubChem (NCBI)