cas: 39560-31-1 — see every product listed under this CAS number, including other names
Methyl 4-(4-Fluorophenyl)-4-oxobutanoate, 98%, 98% (CAS 39560-31-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114RTO-100mg |
| cas | 39560-31-1 |
| size | 100mg |
| availability | 13.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 112.40 Pln | |
| Chemat | 250mg | 131.60 Pln | |
| Chemat | 1g | 203.60 Pln | |
| Chemat | 5g | 616.40 Pln | |
| Chemat | 10g | 1130.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Methyl 4-(4-fluorophenyl)-4-oxobutanoate (CAS 39560-31-1) is a chemical compound with the molecular formula C11H11FO3 and a molecular weight of 210.20 g/mol. IUPAC name: methyl 4-(4-fluorophenyl)-4-oxobutanoate. InChIKey: WVLOAJPINXKMAW-UHFFFAOYSA-N.
| Molecular formula | C11H11FO3 |
|---|---|
| Molecular weight | 210.20 g/mol |
| IUPAC name | methyl 4-(4-fluorophenyl)-4-oxobutanoate |
| InChIKey | WVLOAJPINXKMAW-UHFFFAOYSA-N |
| SMILES | COC(=O)CCC(=O)C1=CC=C(C=C1)F |
Computed by PubChem (NCBI)