cas: 39560-31-1 — see every product listed under this CAS number, including other names
Methyl 4-(4-fluorophenyl)-4-oxobutyrate, 98% (CAS 39560-31-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F033494-1G |
| cas | 39560-31-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 299.91 Pln | |
| Fluorochem | 5g | 799.74 Pln | |
| Fluorochem | 10g | 1544.27 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 4-(4-fluorophenyl)-4-oxobutanoate (CAS 39560-31-1) is a chemical compound with the molecular formula C11H11FO3 and a molecular weight of 210.20 g/mol. IUPAC name: methyl 4-(4-fluorophenyl)-4-oxobutanoate. InChIKey: WVLOAJPINXKMAW-UHFFFAOYSA-N.
| Molecular formula | C11H11FO3 |
|---|---|
| Molecular weight | 210.20 g/mol |
| IUPAC name | methyl 4-(4-fluorophenyl)-4-oxobutanoate |
| InChIKey | WVLOAJPINXKMAW-UHFFFAOYSA-N |
| SMILES | COC(=O)CCC(=O)C1=CC=C(C=C1)F |
Computed by PubChem (NCBI)