Methyl 4-(bromomethyl)-2,3-difluorobenzoate, 97%
cas: 863248-27-5 — see every product listed under this CAS number, including other names
Methyl 4-(bromomethyl)-2,3-difluorobenzoate, 97% (CAS 863248-27-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1448569-100mg |
| cas | 863248-27-5 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 1060.12 Pln | |
| Ambeed | 250mg | 1699.81 Pln | |
| Ambeed | 1g | 4664.62 Pln | |
| BLDpharm | 100mg | 1041.88 Pln | |
| BLDpharm | 250mg | 1669.44 Pln | |
| BLDpharm | 1g | 4573.97 Pln | |
| Chemat | 100mg | 741.20 Pln | |
| Chemat | 250mg | 1216.40 Pln | |
| Chemat | 1g | 3232.40 Pln | |
| Fluorochem | 100mg | 1372.45 Pln | |
| Fluorochem | 250mg | 2257.56 Pln | |
| Fluorochem | 1g | 5995.82 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
Methyl 4-(bromomethyl)-2,3-difluorobenzoate (CAS 863248-27-5) is a chemical compound with the molecular formula C9H7BrF2O2 and a molecular weight of 265.05 g/mol. IUPAC name: methyl 4-(bromomethyl)-2,3-difluorobenzoate. InChIKey: DKTXXBLWUUYFNL-UHFFFAOYSA-N.
| Molecular formula | C9H7BrF2O2 |
|---|---|
| Molecular weight | 265.05 g/mol |
| IUPAC name | methyl 4-(bromomethyl)-2,3-difluorobenzoate |
| InChIKey | DKTXXBLWUUYFNL-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=C(C=C1)CBr)F)F |
Computed by PubChem (NCBI)
Synonyms:
methyl 4-(bromomethyl)-2,3-difluorobenzoate, starbld0002320, DKTXXBLWUUYFNL-UHFFFAOYSA-N, Benzoic acid, 4-(bromomethyl)-2,3-difluoro-, methyl ester, Methyl 4-(bromomethyl)-23-difluorobenzoate, methyl 4-(bromomethyl)-2,3-difluoro-benzoate, 4-bromomethyl-2,3-difluorobenzoic acid methyl ester, 4-Bromomethyl-2,3-difluoro-benzoic acid methyl ester