cas: 24589-98-8 — see every product listed under this CAS number, including other names
Methyl 4-formyl-3-hydroxybenzoate 95% (CAS 24589-98-8) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A116776-50mg |
| cas | 24589-98-8 |
| size | 50mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 125.62 Pln | |
| Ambeed | 100mg | 142.31 Pln | |
| Ambeed | 250mg | 214.62 Pln | |
| Ambeed | 1g | 431.56 Pln | |
| Ambeed | 5g | 1199.19 Pln | |
| Ambeed | 25g | 4542.25 Pln | |
| Ambeed | 100g | 14382.31 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A116776 |
Methyl 4-formyl-3-hydroxybenzoate (CAS 24589-98-8) is a chemical compound with the molecular formula C9H8O4 and a molecular weight of 180.16 g/mol. IUPAC name: methyl 4-formyl-3-hydroxybenzoate. InChIKey: OMCTZIDLDSYPOA-UHFFFAOYSA-N.
| Molecular formula | C9H8O4 |
|---|---|
| Molecular weight | 180.16 g/mol |
| IUPAC name | methyl 4-formyl-3-hydroxybenzoate |
| InChIKey | OMCTZIDLDSYPOA-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)C=O)O |
Computed by PubChem (NCBI)