cas: 62435-37-4 — see every product listed under this CAS number, including other names
Methyl 4-n-octyloxybenzoate, 98%, 98% (CAS 62435-37-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114RW5-1g |
| cas | 62435-37-4 |
| size | 1g |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 117.20 Pln | |
| Chemat | 10g | 126.80 Pln | |
| Chemat | 25g | 146.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Methyl 4-octoxybenzoate (CAS 62435-37-4) is a chemical compound with the molecular formula C16H24O3 and a molecular weight of 264.36 g/mol. IUPAC name: methyl 4-octoxybenzoate. InChIKey: JCVLYBQFVTYGKT-UHFFFAOYSA-N.
| Molecular formula | C16H24O3 |
|---|---|
| Molecular weight | 264.36 g/mol |
| IUPAC name | methyl 4-octoxybenzoate |
| InChIKey | JCVLYBQFVTYGKT-UHFFFAOYSA-N |
| SMILES | CCCCCCCCOC1=CC=C(C=C1)C(=O)OC |
Computed by PubChem (NCBI)