cas: 1194374-71-4 — see every product listed under this CAS number, including other names
Methyl 5-fluoro-2-formylbenzoate 95% (CAS 1194374-71-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A410423-250mg |
| cas | 1194374-71-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 298.06 Pln | |
| Ambeed | 1g | 620.69 Pln | |
| Ambeed | 5g | 1855.56 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A410423 |
Methyl 5-fluoro-2-formylbenzoate (CAS 1194374-71-4) is a chemical compound with the molecular formula C9H7FO3 and a molecular weight of 182.15 g/mol. IUPAC name: methyl 5-fluoro-2-formylbenzoate. InChIKey: OZWXXLYOYCZGTE-UHFFFAOYSA-N.
| Molecular formula | C9H7FO3 |
|---|---|
| Molecular weight | 182.15 g/mol |
| IUPAC name | methyl 5-fluoro-2-formylbenzoate |
| InChIKey | OZWXXLYOYCZGTE-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)F)C=O |
Computed by PubChem (NCBI)