cas: 10177-13-6 — see every product listed under this CAS number, including other names
Methyl 5-phenylnicotinate, 98%, 98% (CAS 10177-13-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1116G5-100mg |
| cas | 10177-13-6 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 232.40 Pln | |
| Chemat | 250mg | 299.60 Pln | |
| Chemat | 1g | 674.00 Pln | |
| Chemat | 5g | 2210.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Methyl 5-phenylpyridine-3-carboxylate (CAS 10177-13-6) is a chemical compound with the molecular formula C13H11NO2 and a molecular weight of 213.23 g/mol. IUPAC name: methyl 5-phenylpyridine-3-carboxylate. InChIKey: CJXJQNNSSJBPBF-UHFFFAOYSA-N.
| Molecular formula | C13H11NO2 |
|---|---|
| Molecular weight | 213.23 g/mol |
| IUPAC name | methyl 5-phenylpyridine-3-carboxylate |
| InChIKey | CJXJQNNSSJBPBF-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CN=CC(=C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)