cas: 33842-18-1 — see every product listed under this CAS number, including other names
Methyl 6-bromobenzo[d][1,3]dioxole-4-carboxylate, 97%, 97% (CAS 33842-18-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11CLMS-100mg |
| cas | 33842-18-1 |
| size | 100mg |
| availability | 5.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 213.20 Pln | |
| Chemat | 250mg | 376.40 Pln | |
| Chemat | 1g | 1029.20 Pln | |
| Chemat | 5g | 4562.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Methyl 6-bromo-1,3-benzodioxole-4-carboxylate (CAS 33842-18-1) is a chemical compound with the molecular formula C9H7BrO4 and a molecular weight of 259.05 g/mol. IUPAC name: methyl 6-bromo-1,3-benzodioxole-4-carboxylate. InChIKey: LCYYWZCNOLIBQE-UHFFFAOYSA-N.
| Molecular formula | C9H7BrO4 |
|---|---|
| Molecular weight | 259.05 g/mol |
| IUPAC name | methyl 6-bromo-1,3-benzodioxole-4-carboxylate |
| InChIKey | LCYYWZCNOLIBQE-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C2C(=CC(=C1)Br)OCO2 |
Computed by PubChem (NCBI)