cas: 206127-25-5 — see every product listed under this CAS number, including other names
Methyl 6-phenylpicolinate 95% (CAS 206127-25-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A603942-250mg |
| cas | 206127-25-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 203.50 Pln | |
| Ambeed | 1g | 331.44 Pln | |
| Ambeed | 5g | 1037.88 Pln | |
| Ambeed | 25g | 3240.62 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A603942 |
Methyl 6-phenylpyridine-2-carboxylate (CAS 206127-25-5) is a chemical compound with the molecular formula C13H11NO2 and a molecular weight of 213.23 g/mol. IUPAC name: methyl 6-phenylpyridine-2-carboxylate. InChIKey: SCLJKMDPGCDUNH-UHFFFAOYSA-N.
| Molecular formula | C13H11NO2 |
|---|---|
| Molecular weight | 213.23 g/mol |
| IUPAC name | methyl 6-phenylpyridine-2-carboxylate |
| InChIKey | SCLJKMDPGCDUNH-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=CC(=N1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)