cas: 1260776-33-7 — see every product listed under this CAS number, including other names
Methyl 7-fluoro-2-oxoindoline-4-carboxylate, 98%, 98% (CAS 1260776-33-7) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111R88-500mg |
| cas | 1260776-33-7 |
| size | 500mg |
| availability | 67g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 500mg | 3486.80 Pln | |
| Chemat | 50mg | 798.80 Pln | |
| Chemat | 100mg | 1211.60 Pln | |
| Chemat | 250mg | 2306.00 Pln | |
| Chemat | 1g | 3674.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Methyl 7-fluoro-2-oxo-1,3-dihydroindole-4-carboxylate (CAS 1260776-33-7) is a chemical compound with the molecular formula C10H8FNO3 and a molecular weight of 209.17 g/mol. IUPAC name: methyl 7-fluoro-2-oxo-1,3-dihydroindole-4-carboxylate. InChIKey: HFRWFBKQGRXZKX-UHFFFAOYSA-N.
| Molecular formula | C10H8FNO3 |
|---|---|
| Molecular weight | 209.17 g/mol |
| IUPAC name | methyl 7-fluoro-2-oxo-1,3-dihydroindole-4-carboxylate |
| InChIKey | HFRWFBKQGRXZKX-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C2CC(=O)NC2=C(C=C1)F |
Computed by PubChem (NCBI)