cas: 1260776-33-7 — see every product listed under this CAS number, including other names
Methyl 7-fluoro-2-oxoindoline-4-carboxylate, 98% (CAS 1260776-33-7) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 100mg, 250mg, 1g, 500mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F232747-25MG |
| cas | 1260776-33-7 |
| size | 25mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25mg | 549.82 Pln | |
| Fluorochem | 100mg | 914.28 Pln | |
| Fluorochem | 250mg | 1419.31 Pln | |
| Fluorochem | 1g | 1695.25 Pln | |
| Fluorochem | 500mg | 1695.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 7-fluoro-2-oxo-1,3-dihydroindole-4-carboxylate (CAS 1260776-33-7) is a chemical compound with the molecular formula C10H8FNO3 and a molecular weight of 209.17 g/mol. IUPAC name: methyl 7-fluoro-2-oxo-1,3-dihydroindole-4-carboxylate. InChIKey: HFRWFBKQGRXZKX-UHFFFAOYSA-N.
| Molecular formula | C10H8FNO3 |
|---|---|
| Molecular weight | 209.17 g/mol |
| IUPAC name | methyl 7-fluoro-2-oxo-1,3-dihydroindole-4-carboxylate |
| InChIKey | HFRWFBKQGRXZKX-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C2CC(=O)NC2=C(C=C1)F |
Computed by PubChem (NCBI)